4-tert-butyl-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine structure
|
Common Name | 4-tert-butyl-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 62773-04-0 | Molecular Weight | 250.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13F3N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2-methylsulfanyl-6-(trifluoromethyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13F3N2S |
|---|---|
| Molecular Weight | 250.28400 |
| Exact Mass | 250.07500 |
| PSA | 51.08000 |
| LogP | 3.51480 |
| InChIKey | IBXMCQJHBZDJHY-UHFFFAOYSA-N |
| SMILES | CSc1nc(C(C)(C)C)cc(C(F)(F)F)n1 |
|
~%
4-tert-butyl-2-... CAS#:62773-04-0 |
| Literature: Ple, N.; Turck, A.; Heynderickx, A.; Queguiner, G. Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 2 p. 551 - 556 |
|
~%
4-tert-butyl-2-... CAS#:62773-04-0 |
| Literature: Ple, N.; Turck, A.; Heynderickx, A.; Queguiner, G. Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 2 p. 551 - 556 |
| Pyrimidine,4-(1,1-dimethylethyl)-2-(methylthio)-6-(trifluoromethyl) |
| 4-tert-butyl-2-methylsulfanyl-6-trifluoromethyl-pyrimidine |
| 2-methylthio-4-trifluoromethyl-6-tert-butylpyrimidine |
| 4-tert-butyl-2-(methylsulfanyl)-6-n(trifluoromethyl)pyrimidine |
| 4-tert-Butyl-2-methylthio-6-trifluormethyl-pyrimidin |