2-(dimethylamino)-4,4-diphenylnonan-5-one structure
|
Common Name | 2-(dimethylamino)-4,4-diphenylnonan-5-one | ||
|---|---|---|---|---|
| CAS Number | 62572-82-1 | Molecular Weight | 337.49800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dimethylamino)-4,4-diphenylnonan-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H31NO |
|---|---|
| Molecular Weight | 337.49800 |
| Exact Mass | 337.24100 |
| PSA | 20.31000 |
| LogP | 5.07220 |
| InChIKey | DUURDWSSXDZDJX-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
|
~%
2-(dimethylamin... CAS#:62572-82-1 |
| Literature: Walton; Ofner; Thorp Journal of the Chemical Society, 1949 , p. 648,651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-dimethylamino-4,4-diphenyl-nonan-5-one |