2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide structure
|
Common Name | 2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 62556-07-4 | Molecular Weight | 298.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H23OP |
|---|---|
| Molecular Weight | 298.35900 |
| Exact Mass | 298.14900 |
| PSA | 26.88000 |
| LogP | 4.46040 |
| InChIKey | XAYMJUHOSXENTI-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)P(=O)(c2ccccc2)c2ccccc21 |
|
~%
2,2,4,4-tetrame... CAS#:62556-07-4 |
| Literature: Grayson,J.I. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2556 - 2562 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phosphinoline,1,2,3,4-tetrahydro-2,2,4,4-tetramethyl-1-phenyl-,1-oxide |
| 2,2,4,4-tetramethyl-1-phenyl-1,2,3,4-tetrahydro-phosphinoline 1-oxide |