2-hydroxy-5-(phenylsulfamoyl)benzoic acid structure
|
Common Name | 2-hydroxy-5-(phenylsulfamoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 62547-03-9 | Molecular Weight | 293.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-5-(phenylsulfamoyl)benzoic acid |
|---|
| Molecular Formula | C13H11NO5S |
|---|---|
| Molecular Weight | 293.29500 |
| Exact Mass | 293.03600 |
| PSA | 112.08000 |
| LogP | 3.04500 |
| InChIKey | GNSAPYSJRSJRRF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccccc2)ccc1O |
|
~75%
2-hydroxy-5-(ph... CAS#:62547-03-9 |
| Literature: Cremlyn, Richard; Swinbourne, Frederick; Atherall, John; Courtney, Lynn; Cronje, Theo; at al. Phosphorus and Sulfur and the Related Elements, 1980 , vol. 9, p. 155 - 164 |
|
~%
2-hydroxy-5-(ph... CAS#:62547-03-9 |
| Literature: Cremlyn, Richard; Swinbourne, Frederick; Atherall, John; Courtney, Lynn; Cronje, Theo; at al. Phosphorus and Sulfur and the Related Elements, 1980 , vol. 9, p. 155 - 164 |
|
~%
2-hydroxy-5-(ph... CAS#:62547-03-9 |
| Literature: Bayer and Co. Patent: DE276331 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 173 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |