5-fluoro-7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline structure
|
Common Name | 5-fluoro-7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 625127-11-9 | Molecular Weight | 219.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-fluoro-7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9F4N |
|---|---|
| Molecular Weight | 219.17900 |
| Exact Mass | 219.06700 |
| PSA | 12.03000 |
| LogP | 2.81900 |
| InChIKey | DQCNEUODNJXURL-UHFFFAOYSA-N |
| SMILES | Cl.Fc1cc(C(F)(F)F)cc2c1CCNC2 |
|
~91%
5-fluoro-7-(tri... CAS#:625127-11-9 |
| Literature: MERCK and CO., INC.; MERCK SHARP and DOHME LIMITED Patent: WO2003/93231 A2, 2003 ; Location in patent: Page/Page column 92-93 ; WO 03/093231 A2 |
|
~%
5-fluoro-7-(tri... CAS#:625127-11-9 |
| Literature: ARES TRADING S.A.; JORAND-LEBRUN, Catherine; SWINNEN, Dominique; GERBER, Patrick; KULKARNI, Santosh Patent: WO2012/130915 A1, 2012 ; WO 2012/130915 A1 |
|
~%
5-fluoro-7-(tri... CAS#:625127-11-9 |
| Literature: ARES TRADING S.A.; JORAND-LEBRUN, Catherine; SWINNEN, Dominique; GERBER, Patrick; KULKARNI, Santosh Patent: WO2012/130915 A1, 2012 ; WO 2012/130915 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| intermediate 7 |
| 5-fluoro-7-trifluoromethyl-1,2,3,4-tetrahydro-isoquinoline |