2-methyl-N-(1-naphthalen-1-ylethyl)prop-2-enamide structure
|
Common Name | 2-methyl-N-(1-naphthalen-1-ylethyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 62445-88-9 | Molecular Weight | 239.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-(1-naphthalen-1-ylethyl)prop-2-enamide |
|---|
| Molecular Formula | C16H17NO |
|---|---|
| Molecular Weight | 239.31200 |
| Exact Mass | 239.13100 |
| PSA | 32.59000 |
| LogP | 4.43340 |
| InChIKey | JPXHGDYEWVJORN-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NC(C)c1cccc2ccccc12 |
|
~%
2-methyl-N-(1-n... CAS#:62445-88-9 |
| Literature: Kohmoto; Miyaji; Tsuruoka; Kishikawa; Yamamoto; Yamada Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 17 p. 2082 - 2088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |