(2-hydroxyphenyl)-(1,2,5-triphenylimidazol-4-yl)methanone structure
|
Common Name | (2-hydroxyphenyl)-(1,2,5-triphenylimidazol-4-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 62283-94-7 | Molecular Weight | 416.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-hydroxyphenyl)-(1,2,5-triphenylimidazol-4-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H20N2O2 |
|---|---|
| Molecular Weight | 416.47100 |
| Exact Mass | 416.15200 |
| PSA | 55.12000 |
| LogP | 6.14290 |
| InChIKey | YHAFXARLSCDKRA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1O)c1nc(-c2ccccc2)n(-c2ccccc2)c1-c1ccccc1 |
|
~%
(2-hydroxypheny... CAS#:62283-94-7 |
| Literature: Katritzky, Alan R.; Michalska, Maria; Harlow, Richard L.; Simonsen, Stanley H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 354 - 361 |
| (2-hydroxy-phenyl)-(1,2,5-triphenyl-1H-imidazol-4-yl)-methanone |
| Methanone,(2-hydroxyphenyl)(1,2,5-triphenyl-1H-imidazol-4-yl) |
| 1,2,5-Triphenyl-4-o-hydroxybenzoylimidazol |
| 4-(o-hydroxybenzoyl)-1,2,5-triphenylimidazole |