2-phenoxy-N-(pyridin-3-ylmethyl)propanamide structure
|
Common Name | 2-phenoxy-N-(pyridin-3-ylmethyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 6223-52-5 | Molecular Weight | 256.30000 | |
| Density | 1.148g/cm3 | Boiling Point | 498.4ºC at 760mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.2ºC | |
| Name | 2-phenoxy-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 498.4ºC at 760mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 255.2ºC |
| Exact Mass | 256.12100 |
| PSA | 54.71000 |
| LogP | 3.00560 |
| Index of Refraction | 1.567 |
| InChIKey | WPPWVLLHTRKZHE-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccccc1)C(=O)NCc1cccnc1 |
|
~%
2-phenoxy-N-(py... CAS#:6223-52-5 |
| Literature: McIntyre,D. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 985 - 989 |
|
~%
2-phenoxy-N-(py... CAS#:6223-52-5 |
| Literature: McIntyre,D. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 985 - 989 |
| HMS2494A24 |
| 2-Phenoxy-N-pyridin-3-ylmethyl-propionamide |
| 4,4-Dibrom-1,2-benzo-cycloocten-3,8-dion |