3,4-dihydroxy-2-nonanoylnaphthalene-1-carbonitrile structure
|
Common Name | 3,4-dihydroxy-2-nonanoylnaphthalene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 61983-27-5 | Molecular Weight | 325.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dihydroxy-2-nonanoylnaphthalene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H23NO3 |
|---|---|
| Molecular Weight | 325.40200 |
| Exact Mass | 325.16800 |
| PSA | 81.32000 |
| LogP | 5.05598 |
| InChIKey | HMWBCRQVFYBPDR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)c1c(O)c(O)c2ccccc2c1C#N |
|
~%
3,4-dihydroxy-2... CAS#:61983-27-5 |
| Literature: Takuwa,A. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2790 - 2799 |
| 1-Naphthalenecarbonitrile,3,4-dihydroxy-2-(1-oxononyl) |
| 1,2-Dihydroxy-3-nonanoyl-4-cyano-naphthalin |