N-(4-methoxyphenyl)-1-methylindole-2-carboxamide structure
|
Common Name | N-(4-methoxyphenyl)-1-methylindole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 61939-21-7 | Molecular Weight | 280.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methoxyphenyl)-1-methylindole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16N2O2 |
|---|---|
| Molecular Weight | 280.32100 |
| Exact Mass | 280.12100 |
| PSA | 43.26000 |
| LogP | 3.51220 |
| InChIKey | OCQCRVSMGYKVAH-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3n2C)cc1 |
|
~%
N-(4-methoxyphe... CAS#:61939-21-7 |
| Literature: Shirley; Roussel Journal of the American Chemical Society, 1953 , vol. 75, p. 375,377 |
| 1-Methyl-indol-2-carbonsaeure-p-anisidid |
| 1-methyl-indole-2-carboxylic acid p-anisidide |
| 1H-Indole-2-carboxamide,N-(4-methoxyphenyl)-1-methyl |