N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]methyl]benzamide structure
|
Common Name | N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]methyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 6182-99-6 | Molecular Weight | 505.56400 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H24FN5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C26H24FN5O3S |
| Molecular Weight | 505.56400 |
| Exact Mass | 505.15800 |
| PSA | 126.93000 |
| LogP | 5.11370 |
| Index of Refraction | 1.643 |
| InChIKey | YIGFSTFUUVJJOM-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(CNC(=O)c3ccccc3)n2-c2ccc(F)cc2)cc1 |
|
~%
N-[[5-[2-(4-eth... CAS#:6182-99-6 |
| Literature: Iskander; Riad Journal of the Chemical Society, 1951 , p. 2054,2057 |
| N-[[5-[(4-ETHOXYPHENYL)CARBAMOYLMETHYLSULFANYL]-4-(4-FLUOROPHENYL)-1,2,4-TRIAZOL-3-YL]METHYL]BENZAMIDE |
| F0507-0145 |
| 2-(4-nitro-benzylsulfanyl)-propionic acid |
| 2-(4-Nitro-benzylmercapto)-propionsaeure |
| N-((5-((2-((4-ethoxyphenyl)amino)-2-oxoethyl)thio)-4-(4-fluorophenyl)-4H-1,2,4-triazol-3-yl)methyl)benzamide |