Ethyl Allyl-(1-Methyl-2-Pentynyl)-Cyanoacetate structure
|
Common Name | Ethyl Allyl-(1-Methyl-2-Pentynyl)-Cyanoacetate | ||
|---|---|---|---|---|
| CAS Number | 61813-51-2 | Molecular Weight | 233.306 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 345.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4±14.6 °C | |
| Name | Ethyl 2-allyl-2-cyano-3-methyl-4-heptynoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.6±42.0 °C at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.306 |
| Flash Point | 164.4±14.6 °C |
| Exact Mass | 233.141586 |
| PSA | 50.09000 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | CWJBQWKCRLZBCR-UHFFFAOYSA-N |
| SMILES | C=CCC(C#N)(C(=O)OCC)C(C)C#CCC |
| HS Code | 2926909090 |
|---|
|
~%
Ethyl Allyl-(1-... CAS#:61813-51-2 |
| Literature: E. Lilly and Co. Patent: US2872448 , 1956 ; |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Allyl-2-cyan-3-methyl-hept-4-insaeure-aethylester |
| 3UU1Y1&XCN&VO2&2U1 |
| Ethyl 2-allyl-2-cyano-3-methyl-4-heptynoate |
| 4-Heptynoic acid, 2-cyano-3-methyl-2-(2-propen-1-yl)-, ethyl ester |
| Di-O-methyl-isolariciresinol |
| 2-Allyl-2-cyano-3-methyl-4-heptynoic acid ethyl ester |
| 2-allyl-2-cyano-3-methyl-hept-4-ynoic acid ethyl ester |