6-methyl-8-nitro-2,4-bis(trichloromethyl)-4H-1,3-benzodioxine structure
|
Common Name | 6-methyl-8-nitro-2,4-bis(trichloromethyl)-4H-1,3-benzodioxine | ||
|---|---|---|---|---|
| CAS Number | 61720-11-4 | Molecular Weight | 429.89600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7Cl6NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-8-nitro-2,4-bis(trichloromethyl)-4H-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7Cl6NO4 |
|---|---|
| Molecular Weight | 429.89600 |
| Exact Mass | 426.85100 |
| PSA | 64.28000 |
| LogP | 5.94300 |
| InChIKey | XEQARQZZMYJJNI-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c([N+](=O)[O-])c1)OC(C(Cl)(Cl)Cl)OC2C(Cl)(Cl)Cl |
|
~%
6-methyl-8-nitr... CAS#:61720-11-4 |
| Literature: Irving; Curtis Journal of the Chemical Society, 1943 , p. 319 |
| 8-nitro-6-methyl-2,4-bis(trichloromethyl)-1,3-benodioxin |
| 4H-1,3-Benzodioxin,6-methyl-8-nitro-2,4-bis(trichloromethyl) |
| 6-Methyl-8-nitro-2,4-bis-trichlormethyl-4H-benzo[1,3]dioxin |
| 6-methyl-8-nitro-2,4-bis-trichloromethyl-4H-benzo[1,3]dioxin |