cyclohexyl 3,4-diaminobenzoate
Modify Date: 2025-09-12 17:15:58
cyclohexyl 3,4-diaminobenzoate structure
|
Common Name | cyclohexyl 3,4-diaminobenzoate | ||
|---|---|---|---|---|
| CAS Number | 616224-21-6 | Molecular Weight | 234.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohexyl 3,4-diaminobenzoate |
|---|
| Molecular Formula | C13H18N2O2 |
|---|---|
| Molecular Weight | 234.29400 |
| Exact Mass | 234.13700 |
| PSA | 78.34000 |
| LogP | 3.50290 |
| InChIKey | FOJCZSAZIXCTFQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)OC2CCCCC2)cc1N |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |