1-[(3-nitrophenyl)-piperidin-1-ylmethyl]piperidine structure
|
Common Name | 1-[(3-nitrophenyl)-piperidin-1-ylmethyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 61456-72-2 | Molecular Weight | 303.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(3-nitrophenyl)-piperidin-1-ylmethyl]piperidine |
|---|
| Molecular Formula | C17H25N3O2 |
|---|---|
| Molecular Weight | 303.39900 |
| Exact Mass | 303.19500 |
| PSA | 52.30000 |
| LogP | 3.96420 |
| InChIKey | KEJVOTRRHNTZCZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(N2CCCCC2)N2CCCCC2)c1 |
|
~79%
1-[(3-nitrophen... CAS#:61456-72-2 |
| Literature: Dezfuli, Mohammad Karimi; Saidi, Mohammad Reza Phosphorus, Sulfur and Silicon and the Related Elements, 2004 , vol. 179, # 1 p. 89 - 96 |