3,3-dichloro-4-(2-morpholin-4-yl-5-nitrophenyl)-1-phenylazetidin-2-one structure
|
Common Name | 3,3-dichloro-4-(2-morpholin-4-yl-5-nitrophenyl)-1-phenylazetidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 61200-74-6 | Molecular Weight | 422.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17Cl2N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dichloro-4-(2-morpholin-4-yl-5-nitrophenyl)-1-phenylazetidin-2-one |
|---|
| Molecular Formula | C19H17Cl2N3O4 |
|---|---|
| Molecular Weight | 422.26200 |
| Exact Mass | 421.06000 |
| PSA | 78.60000 |
| LogP | 4.34640 |
| InChIKey | PIADEXLXTHQJEG-UHFFFAOYSA-N |
| SMILES | O=C1N(c2ccccc2)C(c2cc([N+](=O)[O-])ccc2N2CCOCC2)C1(Cl)Cl |
|
~%
3,3-dichloro-4-... CAS#:61200-74-6 |
| Literature: Bentley,R.L.; Suschitzky,H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1725 - 1734 |