1,2,3-tris(chloromethyl)-4,5,6-trimethylbenzene structure
|
Common Name | 1,2,3-tris(chloromethyl)-4,5,6-trimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61099-18-1 | Molecular Weight | 265.60700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3-tris(chloromethyl)-4,5,6-trimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15Cl3 |
|---|---|
| Molecular Weight | 265.60700 |
| Exact Mass | 264.02400 |
| LogP | 4.82820 |
| InChIKey | YNWBUOUQQLVMIH-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(CCl)c(CCl)c(CCl)c1C |
|
~%
1,2,3-tris(chlo... CAS#:61099-18-1 |
| Literature: Sato,T.; Takemura,T. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1195 - 1201 |
| 4,5,6-Tris(chlormethyl)trimethylbenzol |
| Benzene,1,2,3-tris(chloromethyl)-4,5,6-trimethyl |