1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol,hydrochloride structure
|
Common Name | 1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 60979-28-4 | Molecular Weight | 360.87800 | |
| Density | N/A | Boiling Point | 521.8ºC at 760 mmHg | |
| Molecular Formula | C20H25ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | 1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 521.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.87800 |
| Flash Point | 269.4ºC |
| Exact Mass | 360.16000 |
| PSA | 53.85000 |
| LogP | 4.37790 |
| InChIKey | XGTCGZUATXJKQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)CON=C1c2ccccc2-c2ccccc21.Cl |
| HS Code | 2928000090 |
|---|
|
~48%
1-(tert-butylam... CAS#:60979-28-4 |
| Literature: Amlaiky; Leclerc; Decker; Schwartz European Journal of Medicinal Chemistry, 1983 , vol. 18, # 5 p. 437 - 439 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (tertbutylamino-3-hydroxy-2-propyl) oximino-9-fluorene |
| Ips-339 |
| 9-(3-tert-butylamino-2-hydroxypropoxy)imino-fluorene hydrochloride |
| IPS 339,monohydrochloride,(+-)-isomer |
| 9H-Fluoren-9-one,O-(3-((1,1-dimethylethyl)amino)-2-hydroxypropyl)oxime,monohydrochloride |
| 1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol hydrochloride |