ethyl 4-(phenylcarbamoyloxy)benzenecarbodithioate structure
|
Common Name | ethyl 4-(phenylcarbamoyloxy)benzenecarbodithioate | ||
|---|---|---|---|---|
| CAS Number | 60599-15-7 | Molecular Weight | 317.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(phenylcarbamoyloxy)benzenecarbodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO2S2 |
|---|---|
| Molecular Weight | 317.42600 |
| Exact Mass | 317.05400 |
| PSA | 99.21000 |
| LogP | 4.73970 |
| InChIKey | HVYRUBQDFDOQDG-UHFFFAOYSA-N |
| SMILES | CCSC(=S)c1ccc(OC(=O)Nc2ccccc2)cc1 |
|
~%
ethyl 4-(phenyl... CAS#:60599-15-7 |
| Literature: Leffler; Matson Journal of the American Chemical Society, 1948 , vol. 70, p. 3439,3440,3441 |
| 4-phenylcarbamoyloxy-dithiobenzoic acid ethyl ester |
| 4-Phenylcarbamoyloxy-dithiobenzoesaeure-aethylester |
| Benzenecarbodithioic acid,4-[[(phenylamino)carbonyl]oxy]-,ethyl ester |