2,2,3-trifluoro-3-(trifluoromethyl)inden-1-one
Modify Date: 2025-09-21 19:28:19
2,2,3-trifluoro-3-(trifluoromethyl)inden-1-one structure
|
Common Name | 2,2,3-trifluoro-3-(trifluoromethyl)inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 60375-80-6 | Molecular Weight | 254.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3-trifluoro-3-(trifluoromethyl)inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H4F6O |
|---|---|
| Molecular Weight | 254.12900 |
| Exact Mass | 254.01700 |
| PSA | 17.07000 |
| LogP | 3.24530 |
| InChIKey | GBSARHVTAYAPIX-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(F)(C(F)(F)F)C1(F)F |
|
~%
2,2,3-trifluoro... CAS#:60375-80-6 |
| Literature: Kimoto,H. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1642 - 1649 |
| 2,2,3-Trifluor-3-(trifluormethyl)-1-indanon |
| 1H-Inden-1-one,2,2,3-trifluoro-2,3-dihydro-3-(trifluoromethyl) |
| 2,2,3-Trifluor-3-trifluormethylindanon |