2H-phenanthro[9,10-e][1,2,4]triazine-3-thione
Modify Date: 2025-10-16 19:54:30
![2H-phenanthro[9,10-e][1,2,4]triazine-3-thione Structure](https://image.chemsrc.com/caspic/062/59851-26-2.png)
2H-phenanthro[9,10-e][1,2,4]triazine-3-thione structure
|
Common Name | 2H-phenanthro[9,10-e][1,2,4]triazine-3-thione | ||
|---|---|---|---|---|
| CAS Number | 59851-26-2 | Molecular Weight | 263.31700 | |
| Density | 1.44g/cm3 | Boiling Point | 462.6ºC at 760 mmHg | |
| Molecular Formula | C15H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | 2H-phenanthro[9,10-e][1,2,4]triazine-3-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 462.6ºC at 760 mmHg |
| Molecular Formula | C15H9N3S |
| Molecular Weight | 263.31700 |
| Flash Point | 233.6ºC |
| Exact Mass | 263.05200 |
| PSA | 77.47000 |
| LogP | 3.61990 |
| Index of Refraction | 1.797 |
| InChIKey | RLIWLPICMPQBAG-UHFFFAOYSA-N |
| SMILES | S=c1nc2c3ccccc3c3ccccc3c2n[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,2,4-triazatriphenylene-3-thiol |
| phenanthro[9,10-e][1,2,4]triazine-3-thiol |