(4-tert-butylphenyl)-piperidin-1-ylmethanone structure
|
Common Name | (4-tert-butylphenyl)-piperidin-1-ylmethanone | ||
|---|---|---|---|---|
| CAS Number | 59746-67-7 | Molecular Weight | 245.36000 | |
| Density | 1.017g/cm3 | Boiling Point | 373.7ºC at 760 mmHg | |
| Molecular Formula | C16H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4ºC | |
| Name | (4-tert-butylphenyl)-piperidin-1-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760 mmHg |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.36000 |
| Flash Point | 164.4ºC |
| Exact Mass | 245.17800 |
| PSA | 20.31000 |
| LogP | 3.54810 |
| Index of Refraction | 1.531 |
| InChIKey | QXUQNZDBDBUCLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCCCC2)cc1 |
|
~65%
(4-tert-butylph... CAS#:59746-67-7 |
| Literature: Zhu, Mingwen; Fujita, Ken-Ichi; Yamaguchi, Ryohei Journal of Organic Chemistry, 2012 , vol. 77, # 20 p. 9102 - 9109,8 |
|
~%
(4-tert-butylph... CAS#:59746-67-7 |
| Literature: Im, Li-Ra; Jeon, Sang-Eun; Um, Ik-Hwan Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 4 p. 1153 - 1157 |
| (4-tert-butylphenyl)(piperidin-1-yl)methanone |
| Piperidine,1-(4-(1,1-dimethylethyl)benzoyl) |
| 1-(4-tert-butylbenzoyl)piperidine |