sodium 4-(diphenylphosphino)benzenesulfonate
Modify Date: 2025-09-03 19:06:46
sodium 4-(diphenylphosphino)benzenesulfonate structure
|
Common Name | sodium 4-(diphenylphosphino)benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 5952-62-5 | Molecular Weight | 364.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14NaO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium 4-(diphenylphosphino)benzenesulfonate |
|---|
| Molecular Formula | C18H14NaO3PS |
|---|---|
| Molecular Weight | 364.33000 |
| Exact Mass | 364.03000 |
| PSA | 79.17000 |
| LogP | 3.42970 |
| InChIKey | FECLFAPMMNLAPS-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])c1ccc(P(c2ccccc2)c2ccccc2)cc1.[Na+] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |