9-bromo-9,10-dihydro-9,10-ethano-anthracene-11,12-dicarboxylic acid-anhydride structure
|
Common Name | 9-bromo-9,10-dihydro-9,10-ethano-anthracene-11,12-dicarboxylic acid-anhydride | ||
|---|---|---|---|---|
| CAS Number | 58802-01-0 | Molecular Weight | 355.18200 | |
| Density | 1.691g/cm3 | Boiling Point | 509ºC at 760 mmHg | |
| Molecular Formula | C18H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 9-bromo-9,10-dihydro-9,10-ethano-anthracene-11,12-dicarboxylic acid-anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.691g/cm3 |
|---|---|
| Boiling Point | 509ºC at 760 mmHg |
| Molecular Formula | C18H11BrO3 |
| Molecular Weight | 355.18200 |
| Flash Point | 261.6ºC |
| Exact Mass | 353.98900 |
| PSA | 43.37000 |
| LogP | 3.09980 |
| Index of Refraction | 1.715 |
| InChIKey | FBWNJSWBLCJXRF-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C1C1c3ccccc3C2(Br)c2ccccc21 |
|
~%
9-bromo-9,10-di... CAS#:58802-01-0 |
| Literature: Barnett et al. Journal of the Chemical Society, 1934 , p. 1224,1226 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Brom-9,10-dihydro-9,10-aethano-anthracen-11,12-dicarbonsaeure-anhydrid |