methyl 2-[[2-(2-nitrophenyl)acetyl]amino]acetate
Modify Date: 2025-09-20 17:32:02
![methyl 2-[[2-(2-nitrophenyl)acetyl]amino]acetate Structure](https://image.chemsrc.com/caspic/238/5878-62-6.png)
methyl 2-[[2-(2-nitrophenyl)acetyl]amino]acetate structure
|
Common Name | methyl 2-[[2-(2-nitrophenyl)acetyl]amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 5878-62-6 | Molecular Weight | 252.22300 | |
| Density | 1.306g/cm3 | Boiling Point | 446.7ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | methyl 2-[[2-(2-nitrophenyl)acetyl]amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 446.7ºC at 760 mmHg |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.22300 |
| Flash Point | 223.9ºC |
| Exact Mass | 252.07500 |
| PSA | 104.71000 |
| LogP | 1.79000 |
| Index of Refraction | 1.551 |
| InChIKey | RBXAWSIVJPKHKF-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)Cc1ccccc1[N+](=O)[O-] |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-<2-(2,4,6-Trijod-phenoxy)-aethyl>-theophyllin |
| methyl n-[(2-nitrophenyl)acetyl]glycinate |
| 1,3-dimethyl-7-[2-(2,4,6-triiodo-phenoxy)-ethyl]-3,7-dihydro-purine-2,6-dione |