2-[[3-[bis(2-chloroethyl)amino]-4-methylbenzoyl]amino]benzenesulfonyl fluoride
Modify Date: 2025-09-27 20:03:33
![2-[[3-[bis(2-chloroethyl)amino]-4-methylbenzoyl]amino]benzenesulfonyl fluoride Structure](https://image.chemsrc.com/caspic/267/58278-42-5.png)
2-[[3-[bis(2-chloroethyl)amino]-4-methylbenzoyl]amino]benzenesulfonyl fluoride structure
|
Common Name | 2-[[3-[bis(2-chloroethyl)amino]-4-methylbenzoyl]amino]benzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 58278-42-5 | Molecular Weight | 433.32400 | |
| Density | 1.402g/cm3 | Boiling Point | 508.2ºC at 760 mmHg | |
| Molecular Formula | C18H19Cl2FN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.1ºC | |
| Name | 2-[[3-[bis(2-chloroethyl)amino]-4-methylbenzoyl]amino]benzenesulfonyl fluoride |
|---|
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 508.2ºC at 760 mmHg |
| Molecular Formula | C18H19Cl2FN2O3S |
| Molecular Weight | 433.32400 |
| Flash Point | 261.1ºC |
| Exact Mass | 432.04800 |
| PSA | 78.35000 |
| LogP | 5.65430 |
| Index of Refraction | 1.598 |
| InChIKey | YPPDTFONJUKRKX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2S(=O)(=O)F)cc1N(CCCl)CCCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |