4-chloro-3,3,8-trimethyl-1-oxa-4,8-diazaspiro[4.5]decane structure
|
Common Name | 4-chloro-3,3,8-trimethyl-1-oxa-4,8-diazaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 57822-90-9 | Molecular Weight | 218.72400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-3,3,8-trimethyl-1-oxa-4,8-diazaspiro[4.5]decane |
|---|
| Molecular Formula | C10H19ClN2O |
|---|---|
| Molecular Weight | 218.72400 |
| Exact Mass | 218.11900 |
| PSA | 15.71000 |
| LogP | 1.54870 |
| InChIKey | VTHHDWKRPXMTNZ-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)OCC(C)(C)N2Cl |
|
~%
4-chloro-3,3,8-... CAS#:57822-90-9 |
| Literature: Kaminski; Bodor; Higuchi Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 12 p. 1733 - 1737 |
|
~%
4-chloro-3,3,8-... CAS#:57822-90-9 |
| Literature: Kaminski; Bodor; Higuchi Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 12 p. 1733 - 1737 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |