(2,6-dichloropyridin-4-yl)-(2-methyl-4,5-dihydroimidazol-1-yl)methanone structure
|
Common Name | (2,6-dichloropyridin-4-yl)-(2-methyl-4,5-dihydroimidazol-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 57803-46-0 | Molecular Weight | 258.10400 | |
| Density | 1.5g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | (2,6-dichloropyridin-4-yl)-(2-methyl-4,5-dihydroimidazol-1-yl)methanone |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.10400 |
| Flash Point | 206.1ºC |
| Exact Mass | 257.01200 |
| PSA | 45.56000 |
| LogP | 1.63610 |
| Index of Refraction | 1.66 |
| InChIKey | OPODIOSIQDIKRP-UHFFFAOYSA-N |
| SMILES | CC1=NCCN1C(=O)c1cc(Cl)nc(Cl)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |