1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methyl]benzene structure
|
Common Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 5736-46-9 | Molecular Weight | 348.13900 | |
| Density | 1.65g/cm3 | Boiling Point | 234.5ºC at 760 mmHg | |
| Molecular Formula | C13H2F10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.9ºC | |
| Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 234.5ºC at 760 mmHg |
| Molecular Formula | C13H2F10 |
| Molecular Weight | 348.13900 |
| Flash Point | 81.9ºC |
| Exact Mass | 348.00000 |
| LogP | 4.66840 |
| Index of Refraction | 1.439 |
| InChIKey | BSSLTVJMUSSXTH-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(Cc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Di-(2,3,4,5,6-pentafluorphenyl)methan |
| Decafluoro-diphenylmethan |
| BIS(PENTAFLUOROPHENYL)METHANE |
| Benzene,1,1'-methylenebis[2,3,4,5,6-pentafluoro |
| Di(pentafluorphenyl)methan |
| Methane,bis(pentafluorophenyl) |
| Bis-pentafluorphenyl-methan |