(2-acetyl-4-chlorophenyl) 2-methoxybenzoate structure
|
Common Name | (2-acetyl-4-chlorophenyl) 2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 57006-71-0 | Molecular Weight | 304.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetyl-4-chlorophenyl) 2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13ClO4 |
|---|---|
| Molecular Weight | 304.72500 |
| Exact Mass | 304.05000 |
| PSA | 52.60000 |
| LogP | 3.77040 |
| InChIKey | RAIDAGWMEVJDQA-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)Oc1ccc(Cl)cc1C(C)=O |
|
~85%
(2-acetyl-4-chl... CAS#:57006-71-0 |
| Literature: Mazumdar; Karmakar; Tiwari; Banerjee; Banerji Journal of the Indian Chemical Society, 1990 , vol. 67, # 10 p. 845 - 847 |
| Benzoic acid,2-methoxy-,2-acetyl-4-chlorophenyl ester |