2-N-cyclohexyl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine
Modify Date: 2025-08-25 12:33:47
![2-N-cyclohexyl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine Structure](https://image.chemsrc.com/caspic/020/56968-68-4.png)
2-N-cyclohexyl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine structure
|
Common Name | 2-N-cyclohexyl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 56968-68-4 | Molecular Weight | 367.49100 | |
| Density | 1.245g/cm3 | Boiling Point | 603.8ºC at 760 mmHg | |
| Molecular Formula | C20H29N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319ºC | |
| Name | 2-N-cyclohexyl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 603.8ºC at 760 mmHg |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.49100 |
| Flash Point | 319ºC |
| Exact Mass | 367.24800 |
| PSA | 87.16000 |
| LogP | 1.87550 |
| Index of Refraction | 1.655 |
| InChIKey | FECKDZADEMHWCE-UHFFFAOYSA-N |
| SMILES | Nc1nc(CN2CCN(c3ccccc3)CC2)nc(NC2CCCCC2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |