2-[[6,6-dimethyl-3-(4-methylphenyl)-4-oxo-5,8-dihydrothiopyrano[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide structure
|
Common Name | 2-[[6,6-dimethyl-3-(4-methylphenyl)-4-oxo-5,8-dihydrothiopyrano[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 5660-59-3 | Molecular Weight | 583.78700 | |
| Density | 1.31g/cm3 | Boiling Point | 826.1ºC at 760 mmHg | |
| Molecular Formula | C32H29N3O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 453.4ºC | |
| Name | 2-[[6,6-dimethyl-3-(4-methylphenyl)-4-oxo-5,8-dihydrothiopyrano[2,3]thieno[2,4-b]pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 826.1ºC at 760 mmHg |
| Molecular Formula | C32H29N3O2S3 |
| Molecular Weight | 583.78700 |
| Flash Point | 453.4ºC |
| Exact Mass | 583.14200 |
| PSA | 134.04000 |
| LogP | 7.78050 |
| Index of Refraction | 1.697 |
| InChIKey | DIQJKPGXHNQSMK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(SCC(=O)N(c3ccccc3)c3ccccc3)nc3sc4c(c3c2=O)CC(C)(C)SC4)cc1 |
| HS Code | 2932999099 |
|---|
|
~%
2-[[6,6-dimethy... CAS#:5660-59-3 |
| Literature: Chem. Werke Huels Patent: DE871006 , 1942 ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<Prop-1-in-1-yl>-1,3-dioxolan |