1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-methylbenzene
Modify Date: 2025-09-19 18:16:03
![1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-methylbenzene Structure](https://image.chemsrc.com/caspic/482/56265-27-1.png)
1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-methylbenzene structure
|
Common Name | 1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 56265-27-1 | Molecular Weight | 288.81200 | |
| Density | 1.065g/cm3 | Boiling Point | 398.6ºC at 760 mmHg | |
| Molecular Formula | C18H21ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | 1-[2-chloro-1-(4-ethoxyphenyl)propyl]-4-methylbenzene |
|---|
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760 mmHg |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.81200 |
| Flash Point | 192.6ºC |
| Exact Mass | 288.12800 |
| PSA | 9.23000 |
| LogP | 5.15290 |
| Index of Refraction | 1.545 |
| InChIKey | CCVJJYQDLVQLOB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(c2ccc(C)cc2)C(C)Cl)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |