2-cyclohexyl-3,5-dimethylphenol structure
|
Common Name | 2-cyclohexyl-3,5-dimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 5591-47-9 | Molecular Weight | 204.30800 | |
| Density | 1.013g/cm3 | Boiling Point | 283.7ºC at 760 mmHg | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6ºC | |
| Name | 2-cyclohexyl-3,5-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 283.7ºC at 760 mmHg |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.30800 |
| Flash Point | 127.6ºC |
| Exact Mass | 204.15100 |
| PSA | 20.23000 |
| LogP | 4.05670 |
| Index of Refraction | 1.543 |
| InChIKey | ZEEKNRMEDJKDMO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C2CCCCC2)c(O)c1 |
|
~%
2-cyclohexyl-3,... CAS#:5591-47-9 |
| Literature: Ronchin; Vavasori; Toniolo Journal of Molecular Catalysis A: Chemical, 2012 , vol. 355, p. 134 - 141 |
|
~%
2-cyclohexyl-3,... CAS#:5591-47-9
Detail
|
| Literature: Ronchin; Vavasori; Toniolo Journal of Molecular Catalysis A: Chemical, 2012 , vol. 355, p. 134 - 141 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hexinol |
| Cyclomenolum |
| 3,5-Dimethyl-2-cyclohexyl-phenol |
| Cyclomenol |
| UNII-TB885DRP1J |
| Ciclomenol |