N-(2-methoxyethyl)-2-[3-[2-(2-methoxyethylamino)-2-oxoethyl]-1-adamantyl]acetamide structure
|
Common Name | N-(2-methoxyethyl)-2-[3-[2-(2-methoxyethylamino)-2-oxoethyl]-1-adamantyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5545-28-8 | Molecular Weight | 366.49500 | |
| Density | 1.118g/cm3 | Boiling Point | 583.7ºC at 760 mmHg | |
| Molecular Formula | C20H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.8ºC | |
| Name | N-(2-methoxyethyl)-2-[3-[2-(2-methoxyethylamino)-2-oxoethyl]-1-adamantyl]acetamide |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 583.7ºC at 760 mmHg |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.49500 |
| Flash Point | 306.8ºC |
| Exact Mass | 366.25200 |
| PSA | 83.64000 |
| LogP | 3.55900 |
| Index of Refraction | 1.517 |
| InChIKey | MKGZUPCWKXETPK-UHFFFAOYSA-N |
| SMILES | COCCNC(=O)CC12CC3CC(C1)CC(CC(=O)NCCOC)(C3)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |