ethyl N-carbamoyl-N-(2,3-dimethylphenyl)carbamate
Modify Date: 2025-09-27 18:06:54
ethyl N-carbamoyl-N-(2,3-dimethylphenyl)carbamate structure
|
Common Name | ethyl N-carbamoyl-N-(2,3-dimethylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 55305-75-4 | Molecular Weight | 236.26700 | |
| Density | 1.197g/cm3 | Boiling Point | 370.7ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | ethyl N-carbamoyl-N-(2,3-dimethylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 370.7ºC at 760 mmHg |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.26700 |
| Flash Point | 178ºC |
| Exact Mass | 236.11600 |
| PSA | 73.62000 |
| LogP | 2.85880 |
| Index of Refraction | 1.571 |
| InChIKey | IMULWFGAZXIYLS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C(N)=O)c1cccc(C)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid,(aminocarbonyl)(2,3-dimethylphenyl)-,ethyl ester |
| Allophanic acid,2-(2,3-xylyl)-,ethyl ester |
| SCS 33 |
| N-Ethoxycarbonyl-N-(2,3-dimethylphenyl)-harnstoff |
| (AMINOCARBONYL)(2,3-DIMETHYLPHENYL)CARBAMIC ACID ETHYL ESTER |
| Ethyl (aminocarbonyl)(2,3-dimethylphenyl)carbamate |