4-[2-[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline structure
|
Common Name | 4-[2-[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 54867-74-2 | Molecular Weight | 307.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-[4-(dimethylamino)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H21N3O |
|---|---|
| Molecular Weight | 307.39000 |
| Exact Mass | 307.16800 |
| PSA | 32.51000 |
| LogP | 4.14060 |
| InChIKey | WICWQFPFEQPDRW-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2cnc(-c3ccc(N(C)C)cc3)o2)cc1 |
|
~%
4-[2-[4-(dimeth... CAS#:54867-74-2 |
| Literature: Kerr et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1864 |
|
~%
4-[2-[4-(dimeth... CAS#:54867-74-2 |
| Literature: Kerr et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1864 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Dimethylamino-2,5-diphenyloxazol |
| tetra-N-methyl-4,4'-oxazole-2,5-diyl-bis-aniline |
| 2,5-Bis(p-dimethylaminophenyl)-oxazol |
| 2.5-Bis-<4-dimethylamino-phenyl>-oxazol |
| Benzenamine,4,4'-(2,5-oxazolediyl)bis[N,N-dimethyl |
| tetra-N-methyl-4,4'-oxazole-2,5-diyl-di-aniline |
| Tetra-N-methyl-4,4'-oxazol-2,5-diyl-di-anilin |