5-dimethoxyphosphoryloxy-2-nitrobenzoic acid structure
|
Common Name | 5-dimethoxyphosphoryloxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 54812-32-7 | Molecular Weight | 291.15100 | |
| Density | 1.522g/cm3 | Boiling Point | 420.7ºC at 760 mmHg | |
| Molecular Formula | C9H10NO8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 5-dimethoxyphosphoryloxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 420.7ºC at 760 mmHg |
| Molecular Formula | C9H10NO8P |
| Molecular Weight | 291.15100 |
| Flash Point | 208.2ºC |
| Exact Mass | 291.01400 |
| PSA | 137.69000 |
| LogP | 2.59590 |
| Index of Refraction | 1.555 |
| InChIKey | IWXBJJJCQFKPRI-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
|
~99%
5-dimethoxyphos... CAS#:54812-32-7 |
| Literature: Durand, G.; Abad, J. L.; Sanchez-Baeza, F.; Messeguer, A.; Barcelo, D. Journal of Agricultural and Food Chemistry, 1994 , vol. 42, # 3 p. 814 - 821 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Carboxysumioxon |
| O,O-dimethyl O-(4-nitro-m-carboxyphenyl)phosphate |
| 5-((Dimethoxyphosphinyl)oxy)-2-nitrobenzoic acid |
| Carboxyfenitrooxon |
| 3-Carboxyfenitrooxon |
| BENZOIC ACID,5-((DIMETHOXYPHOSPHINYL)OXY)-2-NITRO |
| O,O-dimethyl O-(3-carboxy-4-nitro)phenyl phosphate |