methyl (2Z)-2-[3-hydroxy-4-(3-methylphenyl)-5-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate
Modify Date: 2025-08-21 00:57:43
![methyl (2Z)-2-[3-hydroxy-4-(3-methylphenyl)-5-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate Structure](https://image.chemsrc.com/caspic/444/54805-66-2.png)
methyl (2Z)-2-[3-hydroxy-4-(3-methylphenyl)-5-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate structure
|
Common Name | methyl (2Z)-2-[3-hydroxy-4-(3-methylphenyl)-5-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 54805-66-2 | Molecular Weight | 350.36500 | |
| Density | 1.312g/cm3 | Boiling Point | 582.4ºC at 760 mmHg | |
| Molecular Formula | C21H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | methyl (2Z)-2-[3-hydroxy-4-(3-methylphenyl)-5-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 582.4ºC at 760 mmHg |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.36500 |
| Flash Point | 209.1ºC |
| Exact Mass | 350.11500 |
| PSA | 72.83000 |
| LogP | 3.71360 |
| Index of Refraction | 1.636 |
| InChIKey | RGESONYUZQQTPP-ZPHPHTNESA-N |
| SMILES | COC(=O)C(=C1OC(=O)C(c2cccc(C)c2)=C1O)c1cccc(C)c1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| methyl (2Z)-2-[5-hydroxy-4-(3-methylphenyl)-3-oxofuran-2-ylidene]-2-(3-methylphenyl)acetate |