4-[2,2,2-trichloro-1-(4-formylphenyl)ethyl]benzaldehyde structure
|
Common Name | 4-[2,2,2-trichloro-1-(4-formylphenyl)ethyl]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 54545-85-6 | Molecular Weight | 341.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2,2,2-trichloro-1-(4-formylphenyl)ethyl]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11Cl3O2 |
|---|---|
| Molecular Weight | 341.61600 |
| Exact Mass | 339.98200 |
| PSA | 34.14000 |
| LogP | 4.81370 |
| InChIKey | DXZLEHBRNSRRBQ-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C(c2ccc(C=O)cc2)C(Cl)(Cl)Cl)cc1 |
|
~%
4-[2,2,2-trichl... CAS#:54545-85-6 |
| Literature: Perron; Barre Canadian Journal of Chemistry, 1952 , vol. 30, p. 203,205 |
|
~%
4-[2,2,2-trichl... CAS#:54545-85-6 |
| Literature: Perron; Barre Canadian Journal of Chemistry, 1952 , vol. 30, p. 203,205 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-(2,2,2-trichloro-ethylidene)-di-benzaldehyde |
| 4,4'-(2,2,2-Trichlor-aethyliden)-di-benzaldehyd |
| Benzaldehyde,4,4'-(2,2,2-trichloroethylidene)bis |