2-acetamido-3-(3-methylphenyl)propanoic acid structure
|
Common Name | 2-acetamido-3-(3-methylphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5440-39-1 | Molecular Weight | 221.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetamido-3-(3-methylphenyl)propanoic acid |
|---|
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 66.40000 |
| LogP | 1.51770 |
| InChIKey | IEZFPBRENQOKIS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1cccc(C)c1)C(=O)O |
|
~%
2-acetamido-3-(... CAS#:5440-39-1 |
| Literature: Andrako,J. et al. Journal of Pharmaceutical Sciences, 1961 , vol. 50, p. 337 - 340 |
|
~%
2-acetamido-3-(... CAS#:5440-39-1 |
| Literature: Andrako,J. et al. Journal of Pharmaceutical Sciences, 1961 , vol. 50, p. 337 - 340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |