7-chloro-5-(2-chlorophenyl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoline
Modify Date: 2025-08-30 22:31:59
![7-chloro-5-(2-chlorophenyl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoline Structure](https://image.chemsrc.com/caspic/407/54196-60-0.png)
7-chloro-5-(2-chlorophenyl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoline structure
|
Common Name | 7-chloro-5-(2-chlorophenyl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoline | ||
|---|---|---|---|---|
| CAS Number | 54196-60-0 | Molecular Weight | 328.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-5-(2-chlorophenyl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H11Cl2N3 |
|---|---|
| Molecular Weight | 328.19500 |
| Exact Mass | 327.03300 |
| PSA | 30.19000 |
| LogP | 5.16470 |
| InChIKey | KAXUQMNUUXACMF-UHFFFAOYSA-N |
| SMILES | Cc1nnc2cc(-c3ccccc3Cl)c3cc(Cl)ccc3n12 |
|
~%
7-chloro-5-(2-c... CAS#:54196-60-0 |
| Literature: The Upjohn Company Patent: US3993660 A1, 1976 ; |
|
~%
7-chloro-5-(2-c... CAS#:54196-60-0 |
| Literature: The Upjohn Company Patent: US4000151 A1, 1976 ; |
![[6-chloro-4-(2-chlorophenyl)quinolin-2-yl]hydrazine structure](https://image.chemsrc.com/caspic/346/62293-35-0.png)
![7-Chloro-1-methyl-5-phenyl-s-triazolo[4,3-a]quinoline structure](https://image.chemsrc.com/caspic/164/36916-18-4.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-chloro-1-methyl-5-(o-chlorophenyl)-s-triazolo[4,3-a]quinoline |
| [1,2,4]Triazolo[4,3-a]quinoline,7-chloro-5-(2-chlorophenyl)-1-methyl |