2,2-dimethyl-1,5-diphenylpentane-1-thione structure
|
Common Name | 2,2-dimethyl-1,5-diphenylpentane-1-thione | ||
|---|---|---|---|---|
| CAS Number | 54007-74-8 | Molecular Weight | 282.44300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-1,5-diphenylpentane-1-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H22S |
|---|---|
| Molecular Weight | 282.44300 |
| Exact Mass | 282.14400 |
| PSA | 32.09000 |
| LogP | 5.45370 |
| InChIKey | MCTNEBBFENKGQE-UHFFFAOYSA-N |
| SMILES | CC(C)(CCCc1ccccc1)C(=S)c1ccccc1 |
|
~%
2,2-dimethyl-1,... CAS#:54007-74-8 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1-Pentanethione,2,2-dimethyl-1,5-diphenyl |
| 1,5-Diphenyl-2,2-dimethyl-1-pentanthion |
| 2,2-Dimethyl-1,5-diphenylpentan-1-thion |