1-(dichloromethyl)-3-phenoxybenzene structure
|
Common Name | 1-(dichloromethyl)-3-phenoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 53874-68-3 | Molecular Weight | 253.12400 | |
| Density | 1.266g/cm3 | Boiling Point | 337.2ºC at 760mmHg | |
| Molecular Formula | C13H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.3ºC | |
| Name | 1-(dichloromethyl)-3-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760mmHg |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.12400 |
| Flash Point | 110.3ºC |
| Exact Mass | 252.01100 |
| PSA | 9.23000 |
| LogP | 4.95510 |
| Index of Refraction | 1.588 |
| InChIKey | JOVSDWRNVGOQNK-UHFFFAOYSA-N |
| SMILES | ClC(Cl)c1cccc(Oc2ccccc2)c1 |
| HS Code | 2909309090 |
|---|
|
~91%
1-(dichlorometh... CAS#:53874-68-3 |
| Literature: Furrow, Michael E.; Myers, Andrew G. Journal of the American Chemical Society, 2004 , vol. 126, # 17 p. 5436 - 5445 |
|
~61%
1-(dichlorometh... CAS#:53874-68-3 |
| Literature: Ethyl Corporation Patent: US4377713 A1, 1983 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 258-833-2 |
| Benzene,1-(dichloromethyl)-3-phenoxy |
| 3-Phenoxybenzal chloride |
| 1,1-dichloro-3'-phenoxytoluene |
| m-Phenoxybenzal chloride |