2,4-dichloro-6-(4-methylphenyl)-1,3,5-triazine structure
|
Common Name | 2,4-dichloro-6-(4-methylphenyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 53815-25-1 | Molecular Weight | 240.08900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dichloro-6-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7Cl2N3 |
|---|---|
| Molecular Weight | 240.08900 |
| Exact Mass | 239.00200 |
| PSA | 38.67000 |
| LogP | 3.15380 |
| InChIKey | HNAOETYOAJQNRU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(Cl)nc(Cl)n2)cc1 |
|
~81%
2,4-dichloro-6-... CAS#:53815-25-1 |
| Literature: Lee, Jae Wook; Bork, Jacqueline T.; Ha, Hyung-Ho; Samanta, Animesh; Chang, Young-Tae Australian Journal of Chemistry, 2009 , vol. 62, # 9 p. 1000 - 1006 |
|
~%
2,4-dichloro-6-... CAS#:53815-25-1 |
| Literature: Zhou, Chunhui; Min, Jaeki; Liu, Zhigang; Young, Anne; Deshazer, Heather; Gao, Tian; Chang, Young-Tae; Kallenbach, Neville R. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 4 p. 1308 - 1311 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-dichloro-6-p-tolyl-[1,3,5]triazine |
| 2,4-Dichlor-6-p-tolyl-s-triazin |
| 2-p-tolyl-4,6-dichloro-s-triazine |
| 2-(p-Tolyl)-4,6-dichlor-1,3,5-triazin |
| 1,3,5-Triazine,2,4-dichloro-6-(4-methylphenyl) |