N-(2,4-dichlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine
Modify Date: 2025-08-24 11:00:30
N-(2,4-dichlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine structure
|
Common Name | N-(2,4-dichlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 5375-38-2 | Molecular Weight | 355.17300 | |
| Density | 1.38g/cm3 | Boiling Point | 535.5ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.7ºC | |
| Name | N-(2,4-dichlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 535.5ºC at 760 mmHg |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.17300 |
| Flash Point | 277.7ºC |
| Exact Mass | 354.01700 |
| PSA | 76.64000 |
| LogP | 5.19260 |
| Index of Refraction | 1.591 |
| InChIKey | ZNTWYRFZTBMIBB-UHFFFAOYSA-N |
| SMILES | COc1cc(C=Nc2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OC |
|
~%
N-(2,4-dichloro... CAS#:5375-38-2 |
| Literature: Crundwell,E.; Cripps,A.L. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 754 - 756 |
|
~%
N-(2,4-dichloro... CAS#:5375-38-2 |
| Literature: Crundwell,E.; Cripps,A.L. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 754 - 756 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 12-Hydroxy-trans,trans-8.10-heptadecadiensaeure |
| 2,4-dichloro-N-[(E)-(4,5-dimethoxy-2-nitrophenyl)methylidene]aniline |
| <12-3H>-12-Hydroxy-heptadecadien-8,10-saeure |
| 12-Hydroxy-(trans-8,trans-10)-heptadecadiensaeure |
| 12-Hydroxyheptadec-trans-8,trans-10-dienoicsaeure |
| 12-Hydroxy-8,10-heptadecadiencarbonsaeure |
| 12-Hydroxy-heptadeca-8-trans,10-trans-diensaeure |