N-tert-butyl-N-(trimethylstannylmethyl)nitrous amide structure
|
Common Name | N-tert-butyl-N-(trimethylstannylmethyl)nitrous amide | ||
|---|---|---|---|---|
| CAS Number | 53462-59-2 | Molecular Weight | 278.95800 | |
| Density | N/A | Boiling Point | 277.4ºC at 760 mmHg | |
| Molecular Formula | C8H20N2OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.6ºC | |
| Name | N-tert-butyl-N-(trimethylstannylmethyl)nitrous amide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 277.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H20N2OSn |
| Molecular Weight | 278.95800 |
| Flash Point | 121.6ºC |
| Exact Mass | 280.06000 |
| PSA | 32.67000 |
| LogP | 2.24520 |
| InChIKey | NKUWGJLEMAPPLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(C[Sn](C)(C)C)N=O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Propanamine,2-methyl-N-nitroso-N-((trimethylstannyl)methyl) |
| 2-Methyl-N-nitroso-N-((trimethylstannyl)methyl)-2-propanamine |