N-[(3-methylphenyl)carbamoyl]-2-(4-methylpiperidin-1-yl)acetamide
Modify Date: 2024-01-23 14:01:10
![N-[(3-methylphenyl)carbamoyl]-2-(4-methylpiperidin-1-yl)acetamide Structure](https://image.chemsrc.com/caspic/196/53413-01-7.png)
N-[(3-methylphenyl)carbamoyl]-2-(4-methylpiperidin-1-yl)acetamide structure
|
Common Name | N-[(3-methylphenyl)carbamoyl]-2-(4-methylpiperidin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 53413-01-7 | Molecular Weight | 289.37300 | |
| Density | 1.135g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3-methylphenyl)carbamoyl]-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.37300 |
| Exact Mass | 289.17900 |
| PSA | 68.42000 |
| LogP | 3.16680 |
| Index of Refraction | 1.564 |
| InChIKey | FZNHDVBMOLCBIZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)NC(=O)CN2CCC(C)CC2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidineacetamide,4-methyl-N-(((3-methylphenyl)amino)carbonyl) |
| 4-Methyl-N-(((3-methylphenyl)amino)carbonyl)-1-piperidineacetamide |
| 2-(4-methyl-piperidin-1-yl)-N-m-tolylcarbamoyl-acetamide |