N-[4-(3,4-dichloroanilino)pyridin-3-yl]sulfonylpropanamide structure
|
Common Name | N-[4-(3,4-dichloroanilino)pyridin-3-yl]sulfonylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 52158-04-0 | Molecular Weight | 374.24200 | |
| Density | 1.477g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(3,4-dichloroanilino)pyridin-3-yl]sulfonylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.24200 |
| Exact Mass | 373.00500 |
| PSA | 103.26000 |
| LogP | 4.68990 |
| Index of Refraction | 1.62 |
| InChIKey | DSOKXOZXZTZELF-UHFFFAOYSA-N |
| SMILES | CCC(=O)NS(=O)(=O)c1cnccc1Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-((4-((3,4-Dichlorophenyl)amino)-3-pyridinyl)sulfonyl)propanamide |
| Propanamide,N-((4-((3,4-dichlorophenyl)amino)-3-pyridinyl)sulfonyl) |
| JDL 198 |