4-formyl-3-hydroxy-N-phenylnaphthalene-2-carboxamide structure
|
Common Name | 4-formyl-3-hydroxy-N-phenylnaphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 52084-73-8 | Molecular Weight | 291.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-formyl-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H13NO3 |
|---|---|
| Molecular Weight | 291.30100 |
| Exact Mass | 291.09000 |
| PSA | 69.89000 |
| LogP | 3.99420 |
| InChIKey | QODOLPZUMYLXKD-UHFFFAOYSA-N |
| SMILES | O=Cc1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
|
~%
4-formyl-3-hydr... CAS#:52084-73-8 |
| Literature: Choubal et al. Journal of the Indian Chemical Society, 1958 , vol. 35, p. 860,861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Naphthalenecarboxamide,4-formyl-3-hydroxy-N-phenyl |